C13H9F4NO4 — CID 167096416
3-methyl-2-(4,5,6,7-tetrafluoro-1,3-dioxoisoindol-2-yl)butanoic acid (PubChem CID 167096416) has the molecular formula C13H9F4NO4 and a molecular weight of 319.21 g/mol. Its IUPAC name is 3-methyl-2-(4,5,6,7-tetrafluoro-1,3-dioxoisoindol-2-yl)butanoic acid.
| Compound Name | 3-methyl-2-(4,5,6,7-tetrafluoro-1,3-dioxoisoindol-2-yl)butanoic acid |
|---|---|
| PubChem CID | 167096416 |
| Molecular Formula | C13H9F4NO4 |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 3-methyl-2-(4,5,6,7-tetrafluoro-1,3-dioxoisoindol-2-yl)butanoic acid |
| SMILES | CC(C)C(C(=O)O)N1C(=O)c2c(F)c(F)c(F)c(F)c2C1=O |
| InChI | InChI=1S/C13H9F4NO4/c1-3(2)10(13(21)22)18-11(19)4-5(12(18)20)7(15)9(17)8(16)6(4)14/h3,10H,1-2H3,(H,21,22) |
| InChIKey | YXFILKZYPAEREX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|