C16H25FO5 — CID 167096730
(4S)-2-fluoro-4-methoxy-2,4-dimethyl-6-(2,2,5-trimethyl-6-oxo-1,3-dioxin-4-yl)hexanal (PubChem CID 167096730) has the molecular formula C16H25FO5 and a molecular weight of 316.37 g/mol. Its IUPAC name is (4S)-2-fluoro-4-methoxy-2,4-dimethyl-6-(2,2,5-trimethyl-6-oxo-1,3-dioxin-4-yl)hexanal.
| Compound Name | (4S)-2-fluoro-4-methoxy-2,4-dimethyl-6-(2,2,5-trimethyl-6-oxo-1,3-dioxin-4-yl)hexanal |
|---|---|
| PubChem CID | 167096730 |
| Molecular Formula | C16H25FO5 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (4S)-2-fluoro-4-methoxy-2,4-dimethyl-6-(2,2,5-trimethyl-6-oxo-1,3-dioxin-4-yl)hexanal |
| SMILES | CO[C@@](C)(CCC1=C(C)C(=O)OC(C)(C)O1)CC(C)(F)C=O |
| InChI | InChI=1S/C16H25FO5/c1-11-12(21-14(2,3)22-13(11)19)7-8-16(5,20-6)9-15(4,17)10-18/h10H,7-9H2,1-6H3/t15?,16-/m0/s1 |
| InChIKey | BXJFXBMRUGNGCN-LYKKTTPLSA-N |
| XLogP | 3.07 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|