C16H15N3O2 — CID 167097322
N-(2-oxo-5-phenyl-1,3,5a,6-tetrahydro-1,4-benzodiazepin-3-yl)formamide (PubChem CID 167097322) has the molecular formula C16H15N3O2 and a molecular weight of 281.31 g/mol. Its IUPAC name is N-(2-oxo-5-phenyl-1,3,5a,6-tetrahydro-1,4-benzodiazepin-3-yl)formamide.
| Compound Name | N-(2-oxo-5-phenyl-1,3,5a,6-tetrahydro-1,4-benzodiazepin-3-yl)formamide |
|---|---|
| PubChem CID | 167097322 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | N-(2-oxo-5-phenyl-1,3,5a,6-tetrahydro-1,4-benzodiazepin-3-yl)formamide |
| SMILES | O=CNC1N=C(c2ccccc2)C2CC=CC=C2NC1=O |
| InChI | InChI=1S/C16H15N3O2/c20-10-17-15-16(21)18-13-9-5-4-8-12(13)14(19-15)11-6-2-1-3-7-11/h1-7,9-10,12,15H,8H2,(H,17,20)(H,18,21) |
| InChIKey | UWRPOPJBZSTFOY-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|