C15H26N8 — CID 167097417
2-N-[(2S)-pentan-2-yl]-7-N-piperidin-4-ylimidazo[2,1-f][1,2,4]triazine-2,4,7-triamine (PubChem CID 167097417) has the molecular formula C15H26N8 and a molecular weight of 318.43 g/mol. Its IUPAC name is 2-N-[(2S)-pentan-2-yl]-7-N-piperidin-4-ylimidazo[2,1-f][1,2,4]triazine-2,4,7-triamine.
| Compound Name | 2-N-[(2S)-pentan-2-yl]-7-N-piperidin-4-ylimidazo[2,1-f][1,2,4]triazine-2,4,7-triamine |
|---|---|
| PubChem CID | 167097417 |
| Molecular Formula | C15H26N8 |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | 2-N-[(2S)-pentan-2-yl]-7-N-piperidin-4-ylimidazo[2,1-f][1,2,4]triazine-2,4,7-triamine |
| SMILES | CCC[C@H](C)Nc1nc(N)c2ncc(NC3CCNCC3)n2n1 |
| InChI | InChI=1S/C15H26N8/c1-3-4-10(2)19-15-21-13(16)14-18-9-12(23(14)22-15)20-11-5-7-17-8-6-11/h9-11,17,20H,3-8H2,1-2H3,(H3,16,19,21,22)/t10-/m0/s1 |
| InChIKey | AKDOHSVZGOGFOM-JTQLQIEISA-N |
| XLogP | 1.47 |
| TPSA | 105.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|