About [4-[2-azaspiro[3.5]nonan-7-yl(methyl)amino]pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite
[4-[2-azaspiro[3.5]nonan-7-yl(methyl)amino]pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite (PubChem CID 167097577) has the molecular formula C15H20IN5S
and a molecular weight of 429.33 g/mol. Its IUPAC name is [4-[2-azaspiro[3.5]nonan-7-yl(methyl)amino]pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite.
Molecular Properties
| Compound Name | [4-[2-azaspiro[3.5]nonan-7-yl(methyl)amino]pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite |
| PubChem CID | 167097577 |
| Molecular Formula | C15H20IN5S |
| Molecular Weight | 429.33 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | [4-[2-azaspiro[3.5]nonan-7-yl(methyl)amino]pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite |
| SMILES | CN(c1ncnc2c1ccn2SI)C1CCC2(CC1)CNC2 |
| InChI | InChI=1S/C15H20IN5S/c1-20(11-2-5-15(6-3-11)8-17-9-15)13-12-4-7-21(22-16)14(12)19-10-18-13/h4,7,10-11,17H,2-3,5-6,8-9H2,1H3 |
| InChIKey | NNMCHFRTWNRBQK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-azaspiro[3.5]nonan-7-yl(methyl)amino]pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-azaspiro[3.5]nonan-7-yl(methyl)amino]pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite?
The IUPAC name of [4-[2-azaspiro[3.5]nonan-7-yl(methyl)amino]pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite (CID 167097577) is [4-[2-azaspiro[3.5]nonan-7-yl(methyl)amino]pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite.
What is the SMILES notation for [4-[2-azaspiro[3.5]nonan-7-yl(methyl)amino]pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite?
The canonical SMILES for [4-[2-azaspiro[3.5]nonan-7-yl(methyl)amino]pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite is CN(c1ncnc2c1ccn2SI)C1CCC2(CC1)CNC2.
What is the InChIKey of [4-[2-azaspiro[3.5]nonan-7-yl(methyl)amino]pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite?
The InChIKey is NNMCHFRTWNRBQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20IN5S/c1-20(11-2-5-15(6-3-11)8-17-9-15)13-12-4-7-21(22-16)14(12)19-10-18-13/h4,7,10-11,17H,2-3,5-6,8-9H2,1H3.
What are the key properties of [4-[2-azaspiro[3.5]nonan-7-yl(methyl)amino]pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite?
[4-[2-azaspiro[3.5]nonan-7-yl(methyl)amino]pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite has a molecular weight of 429.33 g/mol, XLogP of 3.25, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-azaspiro[3.5]nonan-7-yl(methyl)amino]pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite is sourced from PubChem (CID 167097577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).