C26H32N4O4S2 — CID 167097692
(3R,7S,10R,14S)-7,14-dibenzyl-3,10-bis(sulfanylmethyl)-1,4,8,11-tetrazacyclotetradecane-2,5,9,12-tetrone (PubChem CID 167097692) has the molecular formula C26H32N4O4S2 and a molecular weight of 528.70 g/mol. Its IUPAC name is (3R,7S,10R,14S)-7,14-dibenzyl-3,10-bis(sulfanylmethyl)-1,4,8,11-tetrazacyclotetradecane-2,5,9,12-tetrone.
| Compound Name | (3R,7S,10R,14S)-7,14-dibenzyl-3,10-bis(sulfanylmethyl)-1,4,8,11-tetrazacyclotetradecane-2,5,9,12-tetrone |
|---|---|
| PubChem CID | 167097692 |
| Molecular Formula | C26H32N4O4S2 |
| Molecular Weight | 528.70 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | (3R,7S,10R,14S)-7,14-dibenzyl-3,10-bis(sulfanylmethyl)-1,4,8,11-tetrazacyclotetradecane-2,5,9,12-tetrone |
| SMILES | O=C1C[C@H](Cc2ccccc2)NC(=O)[C@H](CS)NC(=O)C[C@H](Cc2ccccc2)NC(=O)[C@H](CS)N1 |
| InChI | InChI=1S/C26H32N4O4S2/c31-23-13-19(11-17-7-3-1-4-8-17)27-25(33)21(15-35)30-24(32)14-20(12-18-9-5-2-6-10-18)28-26(34)22(16-36)29-23/h1-10,19-22,35-36H,11-16H2,(H,27,33)(H,28,34)(H,29,31)(H,30,32)/t19-,20-,21-,22-/m0/s1 |
| InChIKey | GYRLADAZRWSAET-CMOCDZPBSA-N |
| XLogP | 1.06 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.70 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|