C33H61N3O6 — CID 167097976
(6R,8R,9R,10R)-9-[(2S,4S,6R)-4-(dimethylamino)-6-methyloxan-2-yl]oxy-3-(1-ethylpiperidin-3-yl)-8-methoxy-4,6,8,10,12,12-hexamethyl-1-oxa-4-azacyclotridecane-11,13-dione (PubChem CID 167097976) has the molecular formula C33H61N3O6 and a molecular weight of 595.87 g/mol. Its IUPAC name is (6R,8R,9R,10R)-9-[(2S,4S,6R)-4-(dimethylamino)-6-methyloxan-2-yl]oxy-3-(1-ethylpiperidin-3-yl)-8-methoxy-4,6,8,10,12,12-hexamethyl-1-oxa-4-azacyclotridecane-11,13-dione.
| Compound Name | (6R,8R,9R,10R)-9-[(2S,4S,6R)-4-(dimethylamino)-6-methyloxan-2-yl]oxy-3-(1-ethylpiperidin-3-yl)-8-methoxy-4,6,8,10,12,12-hexamethyl-1-oxa-4-azacyclotridecane-11,13-dione |
|---|---|
| PubChem CID | 167097976 |
| Molecular Formula | C33H61N3O6 |
| Molecular Weight | 595.87 g/mol |
| Exact Mass | 595.46 |
| IUPAC Name | (6R,8R,9R,10R)-9-[(2S,4S,6R)-4-(dimethylamino)-6-methyloxan-2-yl]oxy-3-(1-ethylpiperidin-3-yl)-8-methoxy-4,6,8,10,12,12-hexamethyl-1-oxa-4-azacyclotridecane-11,13-dione |
| SMILES | CCN1CCCC(C2COC(=O)C(C)(C)C(=O)[C@H](C)[C@@H](O[C@H]3C[C@@H](N(C)C)C[C@@H](C)O3)[C@](C)(OC)C[C@@H](C)CN2C)C1 |
| InChI | InChI=1S/C33H61N3O6/c1-12-36-15-13-14-25(20-36)27-21-40-31(38)32(5,6)29(37)24(4)30(33(7,39-11)18-22(2)19-35(27)10)42-28-17-26(34(8)9)16-23(3)41-28/h22-28,30H,12-21H2,1-11H3/t22-,23-,24+,25?,26+,27?,28+,30-,33-/m1/s1 |
| InChIKey | BAOCPWARUOEBOT-KVFZBZFSSA-N |
| XLogP | 4.08 |
| TPSA | 80.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.87 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|