C30H37N7O5 — CID 167098376
tert-butyl N-[2-[(5,26-dimethyl-23-oxo-7-oxa-4,5,13,20,22,27-hexazapentacyclo[22.3.1.02,6.013,21.014,19]octacosa-1(27),2(6),3,14(19),15,17,20,24(28),25-nonaen-16-yl)oxy]ethyl]carbamate (PubChem CID 167098376) has the molecular formula C30H37N7O5 and a molecular weight of 575.67 g/mol. Its IUPAC name is tert-butyl N-[2-[(5,26-dimethyl-23-oxo-7-oxa-4,5,13,20,22,27-hexazapentacyclo[22.3.1.02,6.013,21.014,19]octacosa-1(27),2(6),3,14(19),15,17,20,24(28),25-nonaen-16-yl)oxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(5,26-dimethyl-23-oxo-7-oxa-4,5,13,20,22,27-hexazapentacyclo[22.3.1.02,6.013,21.014,19]octacosa-1(27),2(6),3,14(19),15,17,20,24(28),25-nonaen-16-yl)oxy]ethyl]carbamate |
|---|---|
| PubChem CID | 167098376 |
| Molecular Formula | C30H37N7O5 |
| Molecular Weight | 575.67 g/mol |
| Exact Mass | 575.29 |
| IUPAC Name | tert-butyl N-[2-[(5,26-dimethyl-23-oxo-7-oxa-4,5,13,20,22,27-hexazapentacyclo[22.3.1.02,6.013,21.014,19]octacosa-1(27),2(6),3,14(19),15,17,20,24(28),25-nonaen-16-yl)oxy]ethyl]carbamate |
| SMILES | Cc1cc2cc(n1)-c1cnn(C)c1OCCCCCn1c(nc3ccc(OCCNC(=O)OC(C)(C)C)cc31)NC2=O |
| InChI | InChI=1S/C30H37N7O5/c1-19-15-20-16-24(33-19)22-18-32-36(5)27(22)41-13-8-6-7-12-37-25-17-21(9-10-23(25)34-28(37)35-26(20)38)40-14-11-31-29(39)42-30(2,3)4/h9-10,15-18H,6-8,11-14H2,1-5H3,(H,31,39)(H,34,35,38) |
| InChIKey | ULWVEIANVFZUSH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 134.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.67 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|