C12H19N — CID 167098746
(3Z,7Z)-N,7-dimethyl-5-methylidenenona-1,3,7-trien-4-amine (PubChem CID 167098746) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is (3Z,7Z)-N,7-dimethyl-5-methylidenenona-1,3,7-trien-4-amine.
| Compound Name | (3Z,7Z)-N,7-dimethyl-5-methylidenenona-1,3,7-trien-4-amine |
|---|---|
| PubChem CID | 167098746 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | (3Z,7Z)-N,7-dimethyl-5-methylidenenona-1,3,7-trien-4-amine |
| SMILES | C=C/C=C(\NC)C(=C)C/C(C)=C\C |
| InChI | InChI=1S/C12H19N/c1-6-8-12(13-5)11(4)9-10(3)7-2/h6-8,13H,1,4,9H2,2-3,5H3/b10-7-,12-8- |
| InChIKey | FBNQBZBQFHQAMM-NQXFEYKRSA-N |
| XLogP | 3.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|