C19H26O7S — CID 167099081
2-[(2S,3S,4R,5S)-3-(benzenesulfonylmethyl)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-methoxyoxolan-2-yl]acetaldehyde (PubChem CID 167099081) has the molecular formula C19H26O7S and a molecular weight of 398.48 g/mol. Its IUPAC name is 2-[(2S,3S,4R,5S)-3-(benzenesulfonylmethyl)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-methoxyoxolan-2-yl]acetaldehyde.
| Compound Name | 2-[(2S,3S,4R,5S)-3-(benzenesulfonylmethyl)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-methoxyoxolan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 167099081 |
| Molecular Formula | C19H26O7S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 2-[(2S,3S,4R,5S)-3-(benzenesulfonylmethyl)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-methoxyoxolan-2-yl]acetaldehyde |
| SMILES | CO[C@@H]1[C@@H](CS(=O)(=O)c2ccccc2)[C@H](CC=O)O[C@@H]1C1COC(C)(C)O1 |
| InChI | InChI=1S/C19H26O7S/c1-19(2)24-11-16(26-19)18-17(23-3)14(15(25-18)9-10-20)12-27(21,22)13-7-5-4-6-8-13/h4-8,10,14-18H,9,11-12H2,1-3H3/t14-,15-,16?,17+,18+/m0/s1 |
| InChIKey | GBXVWMCKAATEOM-GKSHWJIMSA-N |
| XLogP | 1.60 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|