C14H26O2 — CID 167099102
2-(2,3-dimethylbut-3-enyl)-2-ethyl-5,5-dimethyl-1,3-dioxane (PubChem CID 167099102) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is 2-(2,3-dimethylbut-3-enyl)-2-ethyl-5,5-dimethyl-1,3-dioxane.
| Compound Name | 2-(2,3-dimethylbut-3-enyl)-2-ethyl-5,5-dimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 167099102 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 2-(2,3-dimethylbut-3-enyl)-2-ethyl-5,5-dimethyl-1,3-dioxane |
| SMILES | C=C(C)C(C)CC1(CC)OCC(C)(C)CO1 |
| InChI | InChI=1S/C14H26O2/c1-7-14(8-12(4)11(2)3)15-9-13(5,6)10-16-14/h12H,2,7-10H2,1,3-6H3 |
| InChIKey | DCOGYCWTHJVMMQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|