C18H24O7S — CID 167099152
2-[(2S,4S,5R)-3-(benzenesulfonyl)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-methoxyoxolan-2-yl]acetaldehyde (PubChem CID 167099152) has the molecular formula C18H24O7S and a molecular weight of 384.45 g/mol. Its IUPAC name is 2-[(2S,4S,5R)-3-(benzenesulfonyl)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-methoxyoxolan-2-yl]acetaldehyde.
| Compound Name | 2-[(2S,4S,5R)-3-(benzenesulfonyl)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-methoxyoxolan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 167099152 |
| Molecular Formula | C18H24O7S |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 2-[(2S,4S,5R)-3-(benzenesulfonyl)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-methoxyoxolan-2-yl]acetaldehyde |
| SMILES | CO[C@@H]1C(S(=O)(=O)c2ccccc2)[C@H](CC=O)O[C@@H]1C1COC(C)(C)O1 |
| InChI | InChI=1S/C18H24O7S/c1-18(2)23-11-14(25-18)15-16(22-3)17(13(24-15)9-10-19)26(20,21)12-7-5-4-6-8-12/h4-8,10,13-17H,9,11H2,1-3H3/t13-,14?,15+,16-,17?/m0/s1 |
| InChIKey | VTWJGKHECUMAGT-JPLDOALUSA-N |
| XLogP | 1.35 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|