About trimethyl-[phenyl(2,8,9-trioxa-5-aza-1-germabicyclo[3.3.3]undecan-1-yl)methyl]silane
trimethyl-[phenyl(2,8,9-trioxa-5-aza-1-germabicyclo[3.3.3]undecan-1-yl)methyl]silane (PubChem CID 16709956) has the molecular formula C16H27GeNO3Si
and a molecular weight of 382.09 g/mol. Its IUPAC name is trimethyl-[phenyl(2,8,9-trioxa-5-aza-1-germabicyclo[3.3.3]undecan-1-yl)methyl]silane.
Molecular Properties
| Compound Name | trimethyl-[phenyl(2,8,9-trioxa-5-aza-1-germabicyclo[3.3.3]undecan-1-yl)methyl]silane |
| PubChem CID | 16709956 |
| Molecular Formula | C16H27GeNO3Si |
| Molecular Weight | 382.09 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | trimethyl-[phenyl(2,8,9-trioxa-5-aza-1-germabicyclo[3.3.3]undecan-1-yl)methyl]silane |
| SMILES | C[Si](C)(C)C(c1ccccc1)[Ge]12OCCN(CCO1)CCO2 |
| InChI | InChI=1S/C16H27GeNO3Si/c1-22(2,3)16(15-7-5-4-6-8-15)17-19-12-9-18(10-13-20-17)11-14-21-17/h4-8,16H,9-14H2,1-3H3 |
| InChIKey | UTFLKXKKHNCQQG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.09 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[phenyl(2,8,9-trioxa-5-aza-1-germabicyclo[3.3.3]undecan-1-yl)methyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[phenyl(2,8,9-trioxa-5-aza-1-germabicyclo[3.3.3]undecan-1-yl)methyl]silane?
The IUPAC name of trimethyl-[phenyl(2,8,9-trioxa-5-aza-1-germabicyclo[3.3.3]undecan-1-yl)methyl]silane (CID 16709956) is trimethyl-[phenyl(2,8,9-trioxa-5-aza-1-germabicyclo[3.3.3]undecan-1-yl)methyl]silane.
What is the SMILES notation for trimethyl-[phenyl(2,8,9-trioxa-5-aza-1-germabicyclo[3.3.3]undecan-1-yl)methyl]silane?
The canonical SMILES for trimethyl-[phenyl(2,8,9-trioxa-5-aza-1-germabicyclo[3.3.3]undecan-1-yl)methyl]silane is C[Si](C)(C)C(c1ccccc1)[Ge]12OCCN(CCO1)CCO2.
What is the InChIKey of trimethyl-[phenyl(2,8,9-trioxa-5-aza-1-germabicyclo[3.3.3]undecan-1-yl)methyl]silane?
The InChIKey is UTFLKXKKHNCQQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27GeNO3Si/c1-22(2,3)16(15-7-5-4-6-8-15)17-19-12-9-18(10-13-20-17)11-14-21-17/h4-8,16H,9-14H2,1-3H3.
What are the key properties of trimethyl-[phenyl(2,8,9-trioxa-5-aza-1-germabicyclo[3.3.3]undecan-1-yl)methyl]silane?
trimethyl-[phenyl(2,8,9-trioxa-5-aza-1-germabicyclo[3.3.3]undecan-1-yl)methyl]silane has a molecular weight of 382.09 g/mol, XLogP of 2.50, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[phenyl(2,8,9-trioxa-5-aza-1-germabicyclo[3.3.3]undecan-1-yl)methyl]silane is sourced from PubChem (CID 16709956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).