About (3R)-2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]butan-1-ol
(3R)-2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]butan-1-ol (PubChem CID 167099749) has the molecular formula C15H31NO7S
and a molecular weight of 369.48 g/mol. Its IUPAC name is (3R)-2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]butan-1-ol.
Molecular Properties
| Compound Name | (3R)-2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]butan-1-ol |
| PubChem CID | 167099749 |
| Molecular Formula | C15H31NO7S |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | (3R)-2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]butan-1-ol |
| SMILES | COCCOCCOCCO[C@H](C)C(CO)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C15H31NO7S/c1-14(23-10-9-22-8-7-21-6-5-20-2)15(13-17)16-3-11-24(18,19)12-4-16/h14-15,17H,3-13H2,1-2H3/t14-,15?/m1/s1 |
| InChIKey | UVKAOCXBCCZWOU-GICMACPYSA-N |
| XLogP | -0.84 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3R)-2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]butan-1-ol?
The IUPAC name of (3R)-2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]butan-1-ol (CID 167099749) is (3R)-2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]butan-1-ol.
What is the SMILES notation for (3R)-2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]butan-1-ol?
The canonical SMILES for (3R)-2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]butan-1-ol is COCCOCCOCCO[C@H](C)C(CO)N1CCS(=O)(=O)CC1.
What is the InChIKey of (3R)-2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]butan-1-ol?
The InChIKey is UVKAOCXBCCZWOU-GICMACPYSA-N. The full InChI is InChI=1S/C15H31NO7S/c1-14(23-10-9-22-8-7-21-6-5-20-2)15(13-17)16-3-11-24(18,19)12-4-16/h14-15,17H,3-13H2,1-2H3/t14-,15?/m1/s1.
What are the key properties of (3R)-2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]butan-1-ol?
(3R)-2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]butan-1-ol has a molecular weight of 369.48 g/mol, XLogP of -0.84, 13 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]butan-1-ol is sourced from PubChem (CID 167099749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).