C54H32O2S2 — CID 167099939
7-[4-(2-phenyl-1-benzothiophen-5-yl)phenyl]-2-[4-(2-phenyl-1-benzothiophen-6-yl)phenyl]-[1]benzofuro[6,5-f][1]benzofuran (PubChem CID 167099939) has the molecular formula C54H32O2S2 and a molecular weight of 776.98 g/mol. Its IUPAC name is 7-[4-(2-phenyl-1-benzothiophen-5-yl)phenyl]-2-[4-(2-phenyl-1-benzothiophen-6-yl)phenyl]-[1]benzofuro[6,5-f][1]benzofuran.
| Compound Name | 7-[4-(2-phenyl-1-benzothiophen-5-yl)phenyl]-2-[4-(2-phenyl-1-benzothiophen-6-yl)phenyl]-[1]benzofuro[6,5-f][1]benzofuran |
|---|---|
| PubChem CID | 167099939 |
| Molecular Formula | C54H32O2S2 |
| Molecular Weight | 776.98 g/mol |
| Exact Mass | 776.18 |
| IUPAC Name | 7-[4-(2-phenyl-1-benzothiophen-5-yl)phenyl]-2-[4-(2-phenyl-1-benzothiophen-6-yl)phenyl]-[1]benzofuro[6,5-f][1]benzofuran |
| SMILES | c1ccc(-c2cc3cc(-c4ccc(-c5cc6cc7cc8oc(-c9ccc(-c%10ccc%11cc(-c%12ccccc%12)sc%11c%10)cc9)cc8cc7cc6o5)cc4)ccc3s2)cc1 |
| InChI | InChI=1S/C54H32O2S2/c1-3-7-37(8-4-1)52-31-41-20-19-40(30-54(41)58-52)34-13-17-36(18-14-34)48-29-45-25-43-26-49-44(24-42(43)27-50(45)56-48)28-47(55-49)35-15-11-33(12-16-35)39-21-22-51-46(23-39)32-53(57-51)38-9-5-2-6-10-38/h1-32H |
| InChIKey | BQXYRTNXQVFFKH-UHFFFAOYSA-N |
| XLogP | 16.76 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.98 |
| LogP ≤ 5 | 16.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |