C28H33N5O4 — CID 167100115
8-(2-cyclobutyloxy-6-ethyl-3,4-dihydropyridin-5-yl)-7-(cyclohexa-1,2,3,5-tetraen-1-ylmethyl)-3-ethyl-1-(3-hydroxypropyl)purine-2,6-dione (PubChem CID 167100115) has the molecular formula C28H33N5O4 and a molecular weight of 503.60 g/mol. Its IUPAC name is 8-(2-cyclobutyloxy-6-ethyl-3,4-dihydropyridin-5-yl)-7-(cyclohexa-1,2,3,5-tetraen-1-ylmethyl)-3-ethyl-1-(3-hydroxypropyl)purine-2,6-dione.
| Compound Name | 8-(2-cyclobutyloxy-6-ethyl-3,4-dihydropyridin-5-yl)-7-(cyclohexa-1,2,3,5-tetraen-1-ylmethyl)-3-ethyl-1-(3-hydroxypropyl)purine-2,6-dione |
|---|---|
| PubChem CID | 167100115 |
| Molecular Formula | C28H33N5O4 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | 8-(2-cyclobutyloxy-6-ethyl-3,4-dihydropyridin-5-yl)-7-(cyclohexa-1,2,3,5-tetraen-1-ylmethyl)-3-ethyl-1-(3-hydroxypropyl)purine-2,6-dione |
| SMILES | CCC1=C(c2nc3c(c(=O)n(CCCO)c(=O)n3CC)n2CC2=C=C=CC=C2)CCC(OC2CCC2)=N1 |
| InChI | InChI=1S/C28H33N5O4/c1-3-22-21(14-15-23(29-22)37-20-12-8-13-20)25-30-26-24(33(25)18-19-10-6-5-7-11-19)27(35)32(16-9-17-34)28(36)31(26)4-2/h5-6,10,20,34H,3-4,8-9,12-18H2,1-2H3 |
| InChIKey | KCTFJFLTOVSLDW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 103.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |