C10H14N4OS — CID 167100484
(11R)-11-methyl-4-sulfanyl-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one (PubChem CID 167100484) has the molecular formula C10H14N4OS and a molecular weight of 238.32 g/mol. Its IUPAC name is (11R)-11-methyl-4-sulfanyl-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one.
| Compound Name | (11R)-11-methyl-4-sulfanyl-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
|---|---|
| PubChem CID | 167100484 |
| Molecular Formula | C10H14N4OS |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | (11R)-11-methyl-4-sulfanyl-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-dien-3-one |
| SMILES | C[C@@H]1Cc2nn3c(c2CN1)C(=O)N(S)CC3 |
| InChI | InChI=1S/C10H14N4OS/c1-6-4-8-7(5-11-6)9-10(15)14(16)3-2-13(9)12-8/h6,11,16H,2-5H2,1H3/t6-/m1/s1 |
| InChIKey | BMNWGHKSCVWMOG-ZCFIWIBFSA-N |
| XLogP | 0.22 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|