About 7-chloro-6-[(4,7-dichloro-1-methylindol-2-yl)methyl]-4-fluoro-1,2-dimethylindole
7-chloro-6-[(4,7-dichloro-1-methylindol-2-yl)methyl]-4-fluoro-1,2-dimethylindole (PubChem CID 167100676) has the molecular formula C20H16Cl3FN2
and a molecular weight of 409.72 g/mol. Its IUPAC name is 7-chloro-6-[(4,7-dichloro-1-methylindol-2-yl)methyl]-4-fluoro-1,2-dimethylindole.
Molecular Properties
| Compound Name | 7-chloro-6-[(4,7-dichloro-1-methylindol-2-yl)methyl]-4-fluoro-1,2-dimethylindole |
| PubChem CID | 167100676 |
| Molecular Formula | C20H16Cl3FN2 |
| Molecular Weight | 409.72 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | 7-chloro-6-[(4,7-dichloro-1-methylindol-2-yl)methyl]-4-fluoro-1,2-dimethylindole |
| SMILES | Cc1cc2c(F)cc(Cc3cc4c(Cl)ccc(Cl)c4n3C)c(Cl)c2n1C |
| InChI | InChI=1S/C20H16Cl3FN2/c1-10-6-14-17(24)8-11(18(23)20(14)25(10)2)7-12-9-13-15(21)4-5-16(22)19(13)26(12)3/h4-6,8-9H,7H2,1-3H3 |
| InChIKey | QEKSWWJDTNWAAP-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.72 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-6-[(4,7-dichloro-1-methylindol-2-yl)methyl]-4-fluoro-1,2-dimethylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-6-[(4,7-dichloro-1-methylindol-2-yl)methyl]-4-fluoro-1,2-dimethylindole?
The IUPAC name of 7-chloro-6-[(4,7-dichloro-1-methylindol-2-yl)methyl]-4-fluoro-1,2-dimethylindole (CID 167100676) is 7-chloro-6-[(4,7-dichloro-1-methylindol-2-yl)methyl]-4-fluoro-1,2-dimethylindole.
What is the SMILES notation for 7-chloro-6-[(4,7-dichloro-1-methylindol-2-yl)methyl]-4-fluoro-1,2-dimethylindole?
The canonical SMILES for 7-chloro-6-[(4,7-dichloro-1-methylindol-2-yl)methyl]-4-fluoro-1,2-dimethylindole is Cc1cc2c(F)cc(Cc3cc4c(Cl)ccc(Cl)c4n3C)c(Cl)c2n1C.
What is the InChIKey of 7-chloro-6-[(4,7-dichloro-1-methylindol-2-yl)methyl]-4-fluoro-1,2-dimethylindole?
The InChIKey is QEKSWWJDTNWAAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16Cl3FN2/c1-10-6-14-17(24)8-11(18(23)20(14)25(10)2)7-12-9-13-15(21)4-5-16(22)19(13)26(12)3/h4-6,8-9H,7H2,1-3H3.
What are the key properties of 7-chloro-6-[(4,7-dichloro-1-methylindol-2-yl)methyl]-4-fluoro-1,2-dimethylindole?
7-chloro-6-[(4,7-dichloro-1-methylindol-2-yl)methyl]-4-fluoro-1,2-dimethylindole has a molecular weight of 409.72 g/mol, XLogP of 6.67, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-6-[(4,7-dichloro-1-methylindol-2-yl)methyl]-4-fluoro-1,2-dimethylindole is sourced from PubChem (CID 167100676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).