About 3-iodo-N,1-dimethylpyridin-2-imine
3-iodo-N,1-dimethylpyridin-2-imine (PubChem CID 167100786) has the molecular formula C7H9IN2
and a molecular weight of 248.07 g/mol. Its IUPAC name is 3-iodo-N,1-dimethylpyridin-2-imine.
Molecular Properties
| Compound Name | 3-iodo-N,1-dimethylpyridin-2-imine |
| PubChem CID | 167100786 |
| Molecular Formula | C7H9IN2 |
| Molecular Weight | 248.07 g/mol |
| Exact Mass | 247.98 |
| IUPAC Name | 3-iodo-N,1-dimethylpyridin-2-imine |
| SMILES | C/N=c1\c(I)cccn1C |
| InChI | InChI=1S/C7H9IN2/c1-9-7-6(8)4-3-5-10(7)2/h3-5H,1-2H3/b9-7+ |
| InChIKey | UOEUXSQDCBRUQY-VQHVLOKHSA-N |
| XLogP | 1.16 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.07 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-N,1-dimethylpyridin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-N,1-dimethylpyridin-2-imine?
The IUPAC name of 3-iodo-N,1-dimethylpyridin-2-imine (CID 167100786) is 3-iodo-N,1-dimethylpyridin-2-imine.
What is the SMILES notation for 3-iodo-N,1-dimethylpyridin-2-imine?
The canonical SMILES for 3-iodo-N,1-dimethylpyridin-2-imine is C/N=c1\c(I)cccn1C.
What is the InChIKey of 3-iodo-N,1-dimethylpyridin-2-imine?
The InChIKey is UOEUXSQDCBRUQY-VQHVLOKHSA-N. The full InChI is InChI=1S/C7H9IN2/c1-9-7-6(8)4-3-5-10(7)2/h3-5H,1-2H3/b9-7+.
What are the key properties of 3-iodo-N,1-dimethylpyridin-2-imine?
3-iodo-N,1-dimethylpyridin-2-imine has a molecular weight of 248.07 g/mol, XLogP of 1.16, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-N,1-dimethylpyridin-2-imine is sourced from PubChem (CID 167100786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).