C21H27ClN2O6S — CID 167100963
tert-butyl N-[(7R)-3-(chloromethyl)-2-[hydroxy-[(4-methoxyphenyl)methoxy]methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]carbamate (PubChem CID 167100963) has the molecular formula C21H27ClN2O6S and a molecular weight of 470.98 g/mol. Its IUPAC name is tert-butyl N-[(7R)-3-(chloromethyl)-2-[hydroxy-[(4-methoxyphenyl)methoxy]methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]carbamate.
| Compound Name | tert-butyl N-[(7R)-3-(chloromethyl)-2-[hydroxy-[(4-methoxyphenyl)methoxy]methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]carbamate |
|---|---|
| PubChem CID | 167100963 |
| Molecular Formula | C21H27ClN2O6S |
| Molecular Weight | 470.98 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | tert-butyl N-[(7R)-3-(chloromethyl)-2-[hydroxy-[(4-methoxyphenyl)methoxy]methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]carbamate |
| SMILES | COc1ccc(COC(O)C2=C(CCl)CSC3[C@H](NC(=O)OC(C)(C)C)C(=O)N23)cc1 |
| InChI | InChI=1S/C21H27ClN2O6S/c1-21(2,3)30-20(27)23-15-17(25)24-16(13(9-22)11-31-18(15)24)19(26)29-10-12-5-7-14(28-4)8-6-12/h5-8,15,18-19,26H,9-11H2,1-4H3,(H,23,27)/t15-,18?,19?/m1/s1 |
| InChIKey | QCMGLIFOKAELHL-VNCLNFNDSA-N |
| XLogP | 2.83 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.98 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|