About (2Z,4Z)-8-fluoro-8-iodo-4-methyl-6-methylidenenona-2,4-diene
(2Z,4Z)-8-fluoro-8-iodo-4-methyl-6-methylidenenona-2,4-diene (PubChem CID 167100998) has the molecular formula C11H16FI
and a molecular weight of 294.15 g/mol. Its IUPAC name is (2Z,4Z)-8-fluoro-8-iodo-4-methyl-6-methylidenenona-2,4-diene.
Molecular Properties
| Compound Name | (2Z,4Z)-8-fluoro-8-iodo-4-methyl-6-methylidenenona-2,4-diene |
| PubChem CID | 167100998 |
| Molecular Formula | C11H16FI |
| Molecular Weight | 294.15 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | (2Z,4Z)-8-fluoro-8-iodo-4-methyl-6-methylidenenona-2,4-diene |
| SMILES | C=C(/C=C(C)\C=C/C)CC(C)(F)I |
| InChI | InChI=1S/C11H16FI/c1-5-6-9(2)7-10(3)8-11(4,12)13/h5-7H,3,8H2,1-2,4H3/b6-5-,9-7- |
| InChIKey | FMXVCBZGXZYJOZ-LZWBOMALSA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.15 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4Z)-8-fluoro-8-iodo-4-methyl-6-methylidenenona-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4Z)-8-fluoro-8-iodo-4-methyl-6-methylidenenona-2,4-diene?
The IUPAC name of (2Z,4Z)-8-fluoro-8-iodo-4-methyl-6-methylidenenona-2,4-diene (CID 167100998) is (2Z,4Z)-8-fluoro-8-iodo-4-methyl-6-methylidenenona-2,4-diene.
What is the SMILES notation for (2Z,4Z)-8-fluoro-8-iodo-4-methyl-6-methylidenenona-2,4-diene?
The canonical SMILES for (2Z,4Z)-8-fluoro-8-iodo-4-methyl-6-methylidenenona-2,4-diene is C=C(/C=C(C)\C=C/C)CC(C)(F)I.
What is the InChIKey of (2Z,4Z)-8-fluoro-8-iodo-4-methyl-6-methylidenenona-2,4-diene?
The InChIKey is FMXVCBZGXZYJOZ-LZWBOMALSA-N. The full InChI is InChI=1S/C11H16FI/c1-5-6-9(2)7-10(3)8-11(4,12)13/h5-7H,3,8H2,1-2,4H3/b6-5-,9-7-.
What are the key properties of (2Z,4Z)-8-fluoro-8-iodo-4-methyl-6-methylidenenona-2,4-diene?
(2Z,4Z)-8-fluoro-8-iodo-4-methyl-6-methylidenenona-2,4-diene has a molecular weight of 294.15 g/mol, XLogP of 4.58, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4Z)-8-fluoro-8-iodo-4-methyl-6-methylidenenona-2,4-diene is sourced from PubChem (CID 167100998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).