C23H18FN5O2S — CID 167101688
1-[1-[4-[2-(1-cyanocyclopropyl)-5-fluoro-3-pyridinyl]phenyl]-2-hydroxyethyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea (PubChem CID 167101688) has the molecular formula C23H18FN5O2S and a molecular weight of 447.50 g/mol. Its IUPAC name is 1-[1-[4-[2-(1-cyanocyclopropyl)-5-fluoro-3-pyridinyl]phenyl]-2-hydroxyethyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea.
| Compound Name | 1-[1-[4-[2-(1-cyanocyclopropyl)-5-fluoro-3-pyridinyl]phenyl]-2-hydroxyethyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea |
|---|---|
| PubChem CID | 167101688 |
| Molecular Formula | C23H18FN5O2S |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | 1-[1-[4-[2-(1-cyanocyclopropyl)-5-fluoro-3-pyridinyl]phenyl]-2-hydroxyethyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea |
| SMILES | C#Cc1nc(NC(=O)NC(CO)c2ccc(-c3cc(F)cnc3C3(C#N)CC3)cc2)cs1 |
| InChI | InChI=1S/C23H18FN5O2S/c1-2-20-28-19(12-32-20)29-22(31)27-18(11-30)15-5-3-14(4-6-15)17-9-16(24)10-26-21(17)23(13-25)7-8-23/h1,3-6,9-10,12,18,30H,7-8,11H2,(H2,27,29,31) |
| InChIKey | XMHBZQVXPNDTKO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|