C18H17F2N5O3S — CID 167101784
[2-[4-(3,3-difluoroazetidin-1-yl)phenyl]-2-[(2-ethynyl-1,3-thiazol-4-yl)carbamoylamino]ethyl] carbamate (PubChem CID 167101784) has the molecular formula C18H17F2N5O3S and a molecular weight of 421.43 g/mol. Its IUPAC name is [2-[4-(3,3-difluoroazetidin-1-yl)phenyl]-2-[(2-ethynyl-1,3-thiazol-4-yl)carbamoylamino]ethyl] carbamate.
| Compound Name | [2-[4-(3,3-difluoroazetidin-1-yl)phenyl]-2-[(2-ethynyl-1,3-thiazol-4-yl)carbamoylamino]ethyl] carbamate |
|---|---|
| PubChem CID | 167101784 |
| Molecular Formula | C18H17F2N5O3S |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | [2-[4-(3,3-difluoroazetidin-1-yl)phenyl]-2-[(2-ethynyl-1,3-thiazol-4-yl)carbamoylamino]ethyl] carbamate |
| SMILES | C#Cc1nc(NC(=O)NC(COC(N)=O)c2ccc(N3CC(F)(F)C3)cc2)cs1 |
| InChI | InChI=1S/C18H17F2N5O3S/c1-2-15-23-14(8-29-15)24-17(27)22-13(7-28-16(21)26)11-3-5-12(6-4-11)25-9-18(19,20)10-25/h1,3-6,8,13H,7,9-10H2,(H2,21,26)(H2,22,24,27) |
| InChIKey | DKGKNSQIJNRUCM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|