C22H18F2N4O2S — CID 167101842
1-[1-[5-[2-(2,2-difluorocyclopropyl)phenyl]-2-pyridinyl]-2-hydroxyethyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea (PubChem CID 167101842) has the molecular formula C22H18F2N4O2S and a molecular weight of 440.48 g/mol. Its IUPAC name is 1-[1-[5-[2-(2,2-difluorocyclopropyl)phenyl]-2-pyridinyl]-2-hydroxyethyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea.
| Compound Name | 1-[1-[5-[2-(2,2-difluorocyclopropyl)phenyl]-2-pyridinyl]-2-hydroxyethyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea |
|---|---|
| PubChem CID | 167101842 |
| Molecular Formula | C22H18F2N4O2S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 1-[1-[5-[2-(2,2-difluorocyclopropyl)phenyl]-2-pyridinyl]-2-hydroxyethyl]-3-(2-ethynyl-1,3-thiazol-4-yl)urea |
| SMILES | C#Cc1nc(NC(=O)NC(CO)c2ccc(-c3ccccc3C3CC3(F)F)cn2)cs1 |
| InChI | InChI=1S/C22H18F2N4O2S/c1-2-20-27-19(12-31-20)28-21(30)26-18(11-29)17-8-7-13(10-25-17)14-5-3-4-6-15(14)16-9-22(16,23)24/h1,3-8,10,12,16,18,29H,9,11H2,(H2,26,28,30) |
| InChIKey | QWTLWBJLYLBKRK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|