C15H15F9N2O9S4 — CID 167101974
1,1,2,2,3,3-hexafluoro-N-[2-(4-prop-1-en-2-ylphenoxy)ethylsulfonyl]-N'-(trifluoromethylsulfonyl)propane-1,3-disulfonamide (PubChem CID 167101974) has the molecular formula C15H15F9N2O9S4 and a molecular weight of 666.54 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-N-[2-(4-prop-1-en-2-ylphenoxy)ethylsulfonyl]-N'-(trifluoromethylsulfonyl)propane-1,3-disulfonamide.
| Compound Name | 1,1,2,2,3,3-hexafluoro-N-[2-(4-prop-1-en-2-ylphenoxy)ethylsulfonyl]-N'-(trifluoromethylsulfonyl)propane-1,3-disulfonamide |
|---|---|
| PubChem CID | 167101974 |
| Molecular Formula | C15H15F9N2O9S4 |
| Molecular Weight | 666.54 g/mol |
| Exact Mass | 665.95 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-N-[2-(4-prop-1-en-2-ylphenoxy)ethylsulfonyl]-N'-(trifluoromethylsulfonyl)propane-1,3-disulfonamide |
| SMILES | C=C(C)c1ccc(OCCS(=O)(=O)NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)NS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H15F9N2O9S4/c1-9(2)10-3-5-11(6-4-10)35-7-8-36(27,28)25-37(29,30)13(18,19)12(16,17)14(20,21)38(31,32)26-39(33,34)15(22,23)24/h3-6,25-26H,1,7-8H2,2H3 |
| InChIKey | GILMZYDGOAJHJK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 169.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.54 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|