About 2-cyclopropyl-4-(2,5-dimethyl-4-pyridinyl)-5-methoxypyridine
2-cyclopropyl-4-(2,5-dimethyl-4-pyridinyl)-5-methoxypyridine (PubChem CID 167102230) has the molecular formula C16H18N2O
and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-cyclopropyl-4-(2,5-dimethyl-4-pyridinyl)-5-methoxypyridine.
Molecular Properties
| Compound Name | 2-cyclopropyl-4-(2,5-dimethyl-4-pyridinyl)-5-methoxypyridine |
| PubChem CID | 167102230 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 2-cyclopropyl-4-(2,5-dimethyl-4-pyridinyl)-5-methoxypyridine |
| SMILES | COc1cnc(C2CC2)cc1-c1cc(C)ncc1C |
| InChI | InChI=1S/C16H18N2O/c1-10-8-17-11(2)6-13(10)14-7-15(12-4-5-12)18-9-16(14)19-3/h6-9,12H,4-5H2,1-3H3 |
| InChIKey | XZJVNVGMZDREIK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclopropyl-4-(2,5-dimethyl-4-pyridinyl)-5-methoxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-4-(2,5-dimethyl-4-pyridinyl)-5-methoxypyridine?
The IUPAC name of 2-cyclopropyl-4-(2,5-dimethyl-4-pyridinyl)-5-methoxypyridine (CID 167102230) is 2-cyclopropyl-4-(2,5-dimethyl-4-pyridinyl)-5-methoxypyridine.
What is the SMILES notation for 2-cyclopropyl-4-(2,5-dimethyl-4-pyridinyl)-5-methoxypyridine?
The canonical SMILES for 2-cyclopropyl-4-(2,5-dimethyl-4-pyridinyl)-5-methoxypyridine is COc1cnc(C2CC2)cc1-c1cc(C)ncc1C.
What is the InChIKey of 2-cyclopropyl-4-(2,5-dimethyl-4-pyridinyl)-5-methoxypyridine?
The InChIKey is XZJVNVGMZDREIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O/c1-10-8-17-11(2)6-13(10)14-7-15(12-4-5-12)18-9-16(14)19-3/h6-9,12H,4-5H2,1-3H3.
What are the key properties of 2-cyclopropyl-4-(2,5-dimethyl-4-pyridinyl)-5-methoxypyridine?
2-cyclopropyl-4-(2,5-dimethyl-4-pyridinyl)-5-methoxypyridine has a molecular weight of 254.33 g/mol, XLogP of 3.65, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-4-(2,5-dimethyl-4-pyridinyl)-5-methoxypyridine is sourced from PubChem (CID 167102230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).