About (4Z,6E)-6-(1-sulfanylethyl)octa-4,6-dien-1-ol
(4Z,6E)-6-(1-sulfanylethyl)octa-4,6-dien-1-ol (PubChem CID 167102742) has the molecular formula C10H18OS
and a molecular weight of 186.32 g/mol. Its IUPAC name is (4Z,6E)-6-(1-sulfanylethyl)octa-4,6-dien-1-ol.
Molecular Properties
| Compound Name | (4Z,6E)-6-(1-sulfanylethyl)octa-4,6-dien-1-ol |
| PubChem CID | 167102742 |
| Molecular Formula | C10H18OS |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | (4Z,6E)-6-(1-sulfanylethyl)octa-4,6-dien-1-ol |
| SMILES | C/C=C(\C=C/CCCO)C(C)S |
| InChI | InChI=1S/C10H18OS/c1-3-10(9(2)12)7-5-4-6-8-11/h3,5,7,9,11-12H,4,6,8H2,1-2H3/b7-5-,10-3+ |
| InChIKey | QYYMICLBZYMWRL-RUFITYTOSA-N |
| XLogP | 2.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (4Z,6E)-6-(1-sulfanylethyl)octa-4,6-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z,6E)-6-(1-sulfanylethyl)octa-4,6-dien-1-ol?
The IUPAC name of (4Z,6E)-6-(1-sulfanylethyl)octa-4,6-dien-1-ol (CID 167102742) is (4Z,6E)-6-(1-sulfanylethyl)octa-4,6-dien-1-ol.
What is the SMILES notation for (4Z,6E)-6-(1-sulfanylethyl)octa-4,6-dien-1-ol?
The canonical SMILES for (4Z,6E)-6-(1-sulfanylethyl)octa-4,6-dien-1-ol is C/C=C(\C=C/CCCO)C(C)S.
What is the InChIKey of (4Z,6E)-6-(1-sulfanylethyl)octa-4,6-dien-1-ol?
The InChIKey is QYYMICLBZYMWRL-RUFITYTOSA-N. The full InChI is InChI=1S/C10H18OS/c1-3-10(9(2)12)7-5-4-6-8-11/h3,5,7,9,11-12H,4,6,8H2,1-2H3/b7-5-,10-3+.
What are the key properties of (4Z,6E)-6-(1-sulfanylethyl)octa-4,6-dien-1-ol?
(4Z,6E)-6-(1-sulfanylethyl)octa-4,6-dien-1-ol has a molecular weight of 186.32 g/mol, XLogP of 2.58, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z,6E)-6-(1-sulfanylethyl)octa-4,6-dien-1-ol is sourced from PubChem (CID 167102742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).