C16H26F2O — CID 167102905
(2E,4Z,6Z)-6-butan-2-ylidene-3-(difluoromethoxy)undeca-2,4-diene (PubChem CID 167102905) has the molecular formula C16H26F2O and a molecular weight of 272.38 g/mol. Its IUPAC name is (2E,4Z,6Z)-6-butan-2-ylidene-3-(difluoromethoxy)undeca-2,4-diene.
| Compound Name | (2E,4Z,6Z)-6-butan-2-ylidene-3-(difluoromethoxy)undeca-2,4-diene |
|---|---|
| PubChem CID | 167102905 |
| Molecular Formula | C16H26F2O |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | (2E,4Z,6Z)-6-butan-2-ylidene-3-(difluoromethoxy)undeca-2,4-diene |
| SMILES | C/C=C(\C=C/C(CCCCC)=C(/C)CC)OC(F)F |
| InChI | InChI=1S/C16H26F2O/c1-5-8-9-10-14(13(4)6-2)11-12-15(7-3)19-16(17)18/h7,11-12,16H,5-6,8-10H2,1-4H3/b12-11-,14-13-,15-7+ |
| InChIKey | CNSBMJADWAMRER-GUQIQDKDSA-N |
| XLogP | 5.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|