About 4-[(2E)-2-ethyl-4-fluoropenta-2,4-dienoxy]pent-4-en-2-ol
4-[(2E)-2-ethyl-4-fluoropenta-2,4-dienoxy]pent-4-en-2-ol (PubChem CID 167103519) has the molecular formula C12H19FO2
and a molecular weight of 214.28 g/mol. Its IUPAC name is 4-[(2E)-2-ethyl-4-fluoropenta-2,4-dienoxy]pent-4-en-2-ol.
Molecular Properties
| Compound Name | 4-[(2E)-2-ethyl-4-fluoropenta-2,4-dienoxy]pent-4-en-2-ol |
| PubChem CID | 167103519 |
| Molecular Formula | C12H19FO2 |
| Molecular Weight | 214.28 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 4-[(2E)-2-ethyl-4-fluoropenta-2,4-dienoxy]pent-4-en-2-ol |
| SMILES | C=C(F)/C=C(\CC)COC(=C)CC(C)O |
| InChI | InChI=1S/C12H19FO2/c1-5-12(6-9(2)13)8-15-11(4)7-10(3)14/h6,10,14H,2,4-5,7-8H2,1,3H3/b12-6+ |
| InChIKey | QJEAULMXUGINRK-WUXMJOGZSA-N |
| XLogP | 3.11 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.28 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2E)-2-ethyl-4-fluoropenta-2,4-dienoxy]pent-4-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2E)-2-ethyl-4-fluoropenta-2,4-dienoxy]pent-4-en-2-ol?
The IUPAC name of 4-[(2E)-2-ethyl-4-fluoropenta-2,4-dienoxy]pent-4-en-2-ol (CID 167103519) is 4-[(2E)-2-ethyl-4-fluoropenta-2,4-dienoxy]pent-4-en-2-ol.
What is the SMILES notation for 4-[(2E)-2-ethyl-4-fluoropenta-2,4-dienoxy]pent-4-en-2-ol?
The canonical SMILES for 4-[(2E)-2-ethyl-4-fluoropenta-2,4-dienoxy]pent-4-en-2-ol is C=C(F)/C=C(\CC)COC(=C)CC(C)O.
What is the InChIKey of 4-[(2E)-2-ethyl-4-fluoropenta-2,4-dienoxy]pent-4-en-2-ol?
The InChIKey is QJEAULMXUGINRK-WUXMJOGZSA-N. The full InChI is InChI=1S/C12H19FO2/c1-5-12(6-9(2)13)8-15-11(4)7-10(3)14/h6,10,14H,2,4-5,7-8H2,1,3H3/b12-6+.
What are the key properties of 4-[(2E)-2-ethyl-4-fluoropenta-2,4-dienoxy]pent-4-en-2-ol?
4-[(2E)-2-ethyl-4-fluoropenta-2,4-dienoxy]pent-4-en-2-ol has a molecular weight of 214.28 g/mol, XLogP of 3.11, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2E)-2-ethyl-4-fluoropenta-2,4-dienoxy]pent-4-en-2-ol is sourced from PubChem (CID 167103519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).