C7H12FNO2 — CID 167103857
(1R,2S,5S)-5-amino-3-(fluoromethyl)cyclohex-3-ene-1,2-diol (PubChem CID 167103857) has the molecular formula C7H12FNO2 and a molecular weight of 161.18 g/mol. Its IUPAC name is (1R,2S,5S)-5-amino-3-(fluoromethyl)cyclohex-3-ene-1,2-diol.
| Compound Name | (1R,2S,5S)-5-amino-3-(fluoromethyl)cyclohex-3-ene-1,2-diol |
|---|---|
| PubChem CID | 167103857 |
| Molecular Formula | C7H12FNO2 |
| Molecular Weight | 161.18 g/mol |
| Exact Mass | 161.09 |
| IUPAC Name | (1R,2S,5S)-5-amino-3-(fluoromethyl)cyclohex-3-ene-1,2-diol |
| SMILES | N[C@@H]1C=C(CF)[C@H](O)[C@H](O)C1 |
| InChI | InChI=1S/C7H12FNO2/c8-3-4-1-5(9)2-6(10)7(4)11/h1,5-7,10-11H,2-3,9H2/t5-,6-,7+/m1/s1 |
| InChIKey | WPNMVKPLDKCXRG-QYNIQEEDSA-N |
| XLogP | -0.66 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.18 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|