C11H17N3 — CID 167104094
2-[[(2E,4E,6Z)-4-methylocta-2,4,6-trienylidene]amino]ethene-1,1-diamine (PubChem CID 167104094) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is 2-[[(2E,4E,6Z)-4-methylocta-2,4,6-trienylidene]amino]ethene-1,1-diamine.
| Compound Name | 2-[[(2E,4E,6Z)-4-methylocta-2,4,6-trienylidene]amino]ethene-1,1-diamine |
|---|---|
| PubChem CID | 167104094 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 2-[[(2E,4E,6Z)-4-methylocta-2,4,6-trienylidene]amino]ethene-1,1-diamine |
| SMILES | C/C=C\C=C(C)\C=C\C=N\C=C(N)N |
| InChI | InChI=1S/C11H17N3/c1-3-4-6-10(2)7-5-8-14-9-11(12)13/h3-9H,12-13H2,1-2H3/b4-3-,7-5+,10-6+,14-8+ |
| InChIKey | UFNSPUUXRXLVIC-OANAOAAOSA-N |
| XLogP | 1.85 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|