About 2-N-[(1-propylcyclohexyl)methyl]hept-1-ene-2,3,6-triamine
2-N-[(1-propylcyclohexyl)methyl]hept-1-ene-2,3,6-triamine (PubChem CID 167104256) has the molecular formula C17H35N3
and a molecular weight of 281.49 g/mol. Its IUPAC name is 2-N-[(1-propylcyclohexyl)methyl]hept-1-ene-2,3,6-triamine.
Molecular Properties
| Compound Name | 2-N-[(1-propylcyclohexyl)methyl]hept-1-ene-2,3,6-triamine |
| PubChem CID | 167104256 |
| Molecular Formula | C17H35N3 |
| Molecular Weight | 281.49 g/mol |
| Exact Mass | 281.28 |
| IUPAC Name | 2-N-[(1-propylcyclohexyl)methyl]hept-1-ene-2,3,6-triamine |
| SMILES | C=C(NCC1(CCC)CCCCC1)C(N)CCC(C)N |
| InChI | InChI=1S/C17H35N3/c1-4-10-17(11-6-5-7-12-17)13-20-15(3)16(19)9-8-14(2)18/h14,16,20H,3-13,18-19H2,1-2H3 |
| InChIKey | YPMOXPQOYQJDBQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.49 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-N-[(1-propylcyclohexyl)methyl]hept-1-ene-2,3,6-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-[(1-propylcyclohexyl)methyl]hept-1-ene-2,3,6-triamine?
The IUPAC name of 2-N-[(1-propylcyclohexyl)methyl]hept-1-ene-2,3,6-triamine (CID 167104256) is 2-N-[(1-propylcyclohexyl)methyl]hept-1-ene-2,3,6-triamine.
What is the SMILES notation for 2-N-[(1-propylcyclohexyl)methyl]hept-1-ene-2,3,6-triamine?
The canonical SMILES for 2-N-[(1-propylcyclohexyl)methyl]hept-1-ene-2,3,6-triamine is C=C(NCC1(CCC)CCCCC1)C(N)CCC(C)N.
What is the InChIKey of 2-N-[(1-propylcyclohexyl)methyl]hept-1-ene-2,3,6-triamine?
The InChIKey is YPMOXPQOYQJDBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35N3/c1-4-10-17(11-6-5-7-12-17)13-20-15(3)16(19)9-8-14(2)18/h14,16,20H,3-13,18-19H2,1-2H3.
What are the key properties of 2-N-[(1-propylcyclohexyl)methyl]hept-1-ene-2,3,6-triamine?
2-N-[(1-propylcyclohexyl)methyl]hept-1-ene-2,3,6-triamine has a molecular weight of 281.49 g/mol, XLogP of 3.30, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-[(1-propylcyclohexyl)methyl]hept-1-ene-2,3,6-triamine is sourced from PubChem (CID 167104256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).