About 3-pentyloctyl 10-[3-(1-methylpyrrolidin-3-yl)but-3-enyl]nonadecanoate
3-pentyloctyl 10-[3-(1-methylpyrrolidin-3-yl)but-3-enyl]nonadecanoate (PubChem CID 167104424) has the molecular formula C41H79NO2
and a molecular weight of 618.09 g/mol. Its IUPAC name is 3-pentyloctyl 10-[3-(1-methylpyrrolidin-3-yl)but-3-enyl]nonadecanoate.
Molecular Properties
| Compound Name | 3-pentyloctyl 10-[3-(1-methylpyrrolidin-3-yl)but-3-enyl]nonadecanoate |
| PubChem CID | 167104424 |
| Molecular Formula | C41H79NO2 |
| Molecular Weight | 618.09 g/mol |
| Exact Mass | 617.61 |
| IUPAC Name | 3-pentyloctyl 10-[3-(1-methylpyrrolidin-3-yl)but-3-enyl]nonadecanoate |
| SMILES | C=C(CCC(CCCCCCCCC)CCCCCCCCC(=O)OCCC(CCCCC)CCCCC)C1CCN(C)C1 |
| InChI | InChI=1S/C41H79NO2/c1-6-9-12-13-14-17-22-27-38(31-30-37(4)40-32-34-42(5)36-40)28-23-18-15-16-19-24-29-41(43)44-35-33-39(25-20-10-7-2)26-21-11-8-3/h38-40H,4,6-36H2,1-3,5H3 |
| InChIKey | YROWYPLLBSAFJT-UHFFFAOYSA-N |
| XLogP | 12.86 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 618.09 |
| LogP ≤ 5 | 12.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-pentyloctyl 10-[3-(1-methylpyrrolidin-3-yl)but-3-enyl]nonadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pentyloctyl 10-[3-(1-methylpyrrolidin-3-yl)but-3-enyl]nonadecanoate?
The IUPAC name of 3-pentyloctyl 10-[3-(1-methylpyrrolidin-3-yl)but-3-enyl]nonadecanoate (CID 167104424) is 3-pentyloctyl 10-[3-(1-methylpyrrolidin-3-yl)but-3-enyl]nonadecanoate.
What is the SMILES notation for 3-pentyloctyl 10-[3-(1-methylpyrrolidin-3-yl)but-3-enyl]nonadecanoate?
The canonical SMILES for 3-pentyloctyl 10-[3-(1-methylpyrrolidin-3-yl)but-3-enyl]nonadecanoate is C=C(CCC(CCCCCCCCC)CCCCCCCCC(=O)OCCC(CCCCC)CCCCC)C1CCN(C)C1.
What is the InChIKey of 3-pentyloctyl 10-[3-(1-methylpyrrolidin-3-yl)but-3-enyl]nonadecanoate?
The InChIKey is YROWYPLLBSAFJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C41H79NO2/c1-6-9-12-13-14-17-22-27-38(31-30-37(4)40-32-34-42(5)36-40)28-23-18-15-16-19-24-29-41(43)44-35-33-39(25-20-10-7-2)26-21-11-8-3/h38-40H,4,6-36H2,1-3,5H3.
What are the key properties of 3-pentyloctyl 10-[3-(1-methylpyrrolidin-3-yl)but-3-enyl]nonadecanoate?
3-pentyloctyl 10-[3-(1-methylpyrrolidin-3-yl)but-3-enyl]nonadecanoate has a molecular weight of 618.09 g/mol, XLogP of 12.86, 32 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pentyloctyl 10-[3-(1-methylpyrrolidin-3-yl)but-3-enyl]nonadecanoate is sourced from PubChem (CID 167104424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).