C17H22N4 — CID 167104445
N-(1-cyclopropylethenyl)-5-ethenyl-1-[(3E,5Z)-3-methylhepta-1,3,5-trien-2-yl]-1,2,4-triazol-3-amine (PubChem CID 167104445) has the molecular formula C17H22N4 and a molecular weight of 282.39 g/mol. Its IUPAC name is N-(1-cyclopropylethenyl)-5-ethenyl-1-[(3E,5Z)-3-methylhepta-1,3,5-trien-2-yl]-1,2,4-triazol-3-amine.
| Compound Name | N-(1-cyclopropylethenyl)-5-ethenyl-1-[(3E,5Z)-3-methylhepta-1,3,5-trien-2-yl]-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 167104445 |
| Molecular Formula | C17H22N4 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | N-(1-cyclopropylethenyl)-5-ethenyl-1-[(3E,5Z)-3-methylhepta-1,3,5-trien-2-yl]-1,2,4-triazol-3-amine |
| SMILES | C=Cc1nc(NC(=C)C2CC2)nn1C(=C)/C(C)=C/C=C\C |
| InChI | InChI=1S/C17H22N4/c1-6-8-9-12(3)14(5)21-16(7-2)19-17(20-21)18-13(4)15-10-11-15/h6-9,15H,2,4-5,10-11H2,1,3H3,(H,18,20)/b8-6-,12-9+ |
| InChIKey | HHQGESYRQAMFFS-ZHAQITPWSA-N |
| XLogP | 4.25 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|