C18H21N7O4S — CID 167104456
N-[5-[5-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-1,3,4-oxadiazol-2-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]cyclobutanecarboxamide (PubChem CID 167104456) has the molecular formula C18H21N7O4S and a molecular weight of 431.48 g/mol. Its IUPAC name is N-[5-[5-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-1,3,4-oxadiazol-2-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]cyclobutanecarboxamide.
| Compound Name | N-[5-[5-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-1,3,4-oxadiazol-2-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 167104456 |
| Molecular Formula | C18H21N7O4S |
| Molecular Weight | 431.48 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | N-[5-[5-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-1,3,4-oxadiazol-2-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]cyclobutanecarboxamide |
| SMILES | O=C(Nc1nc2cccc(-c3nnc(CN4CCS(=O)(=O)CC4)o3)n2n1)C1CCC1 |
| InChI | InChI=1S/C18H21N7O4S/c26-16(12-3-1-4-12)20-18-19-14-6-2-5-13(25(14)23-18)17-22-21-15(29-17)11-24-7-9-30(27,28)10-8-24/h2,5-6,12H,1,3-4,7-11H2,(H,20,23,26) |
| InChIKey | JSTWXHYXBLIFFA-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 135.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.48 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |