C19H20FN5O3S2 — CID 167104465
N-[5-[5-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]thiophen-2-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-2-fluorocyclopropane-1-carboxamide (PubChem CID 167104465) has the molecular formula C19H20FN5O3S2 and a molecular weight of 449.53 g/mol. Its IUPAC name is N-[5-[5-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]thiophen-2-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-2-fluorocyclopropane-1-carboxamide.
| Compound Name | N-[5-[5-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]thiophen-2-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-2-fluorocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 167104465 |
| Molecular Formula | C19H20FN5O3S2 |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | N-[5-[5-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]thiophen-2-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-2-fluorocyclopropane-1-carboxamide |
| SMILES | O=C(Nc1nc2cccc(-c3ccc(CN4CCS(=O)(=O)CC4)s3)n2n1)C1CC1F |
| InChI | InChI=1S/C19H20FN5O3S2/c20-14-10-13(14)18(26)22-19-21-17-3-1-2-15(25(17)23-19)16-5-4-12(29-16)11-24-6-8-30(27,28)9-7-24/h1-5,13-14H,6-11H2,(H,22,23,26) |
| InChIKey | MVOVHRYBJWDADP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |