C30H41NO — CID 167105439
(4E,7Z,9Z)-9-methyl-6-methylidene-4-phenyl-5-[(2E,4E)-5-piperidin-4-ylhexa-2,4-dien-2-yl]undeca-4,7,9-trien-1-ol (PubChem CID 167105439) has the molecular formula C30H41NO and a molecular weight of 431.66 g/mol. Its IUPAC name is (4E,7Z,9Z)-9-methyl-6-methylidene-4-phenyl-5-[(2E,4E)-5-piperidin-4-ylhexa-2,4-dien-2-yl]undeca-4,7,9-trien-1-ol.
| Compound Name | (4E,7Z,9Z)-9-methyl-6-methylidene-4-phenyl-5-[(2E,4E)-5-piperidin-4-ylhexa-2,4-dien-2-yl]undeca-4,7,9-trien-1-ol |
|---|---|
| PubChem CID | 167105439 |
| Molecular Formula | C30H41NO |
| Molecular Weight | 431.66 g/mol |
| Exact Mass | 431.32 |
| IUPAC Name | (4E,7Z,9Z)-9-methyl-6-methylidene-4-phenyl-5-[(2E,4E)-5-piperidin-4-ylhexa-2,4-dien-2-yl]undeca-4,7,9-trien-1-ol |
| SMILES | C=C(/C=C\C(C)=C/C)C(=C(\CCCO)c1ccccc1)/C(C)=C/C=C(\C)C1CCNCC1 |
| InChI | InChI=1S/C30H41NO/c1-6-23(2)14-15-25(4)30(29(13-10-22-32)28-11-8-7-9-12-28)26(5)17-16-24(3)27-18-20-31-21-19-27/h6-9,11-12,14-17,27,31-32H,4,10,13,18-22H2,1-3,5H3/b15-14-,23-6-,24-16+,26-17+,30-29- |
| InChIKey | IEEQJUARLFLKQM-ABSUBYKUSA-N |
| XLogP | 7.18 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.66 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|