C20H21Cl2N7O2 — CID 167106282
N-[1-(3-carbamimidoyl-2-hydroxyphenyl)pyrrolidin-3-yl]-2,6-dichloro-4-(dimethanimidoylamino)benzamide (PubChem CID 167106282) has the molecular formula C20H21Cl2N7O2 and a molecular weight of 462.34 g/mol. Its IUPAC name is N-[1-(3-carbamimidoyl-2-hydroxyphenyl)pyrrolidin-3-yl]-2,6-dichloro-4-(dimethanimidoylamino)benzamide.
| Compound Name | N-[1-(3-carbamimidoyl-2-hydroxyphenyl)pyrrolidin-3-yl]-2,6-dichloro-4-(dimethanimidoylamino)benzamide |
|---|---|
| PubChem CID | 167106282 |
| Molecular Formula | C20H21Cl2N7O2 |
| Molecular Weight | 462.34 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | N-[1-(3-carbamimidoyl-2-hydroxyphenyl)pyrrolidin-3-yl]-2,6-dichloro-4-(dimethanimidoylamino)benzamide |
| SMILES | [H]/N=C(\N)c1cccc(N2CCC(NC(=O)c3c(Cl)cc(N(/C=N/[H])/C=N/[H])cc3Cl)C2)c1O |
| InChI | InChI=1S/C20H21Cl2N7O2/c21-14-6-12(29(9-23)10-24)7-15(22)17(14)20(31)27-11-4-5-28(8-11)16-3-1-2-13(18(16)30)19(25)26/h1-3,6-7,9-11,23-24,30H,4-5,8H2,(H3,25,26)(H,27,31)/b23-9+,24-10+ |
| InChIKey | HXRLQJRUSIMMIV-WDBPGAOMSA-N |
| XLogP | 3.01 |
| TPSA | 153.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|