C14H22N2 — CID 167106494
(Z)-N'-[(1Z,4Z)-4-ethyl-3-methylidenehexa-1,4-dienyl]pent-3-enimidamide (PubChem CID 167106494) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is (Z)-N'-[(1Z,4Z)-4-ethyl-3-methylidenehexa-1,4-dienyl]pent-3-enimidamide.
| Compound Name | (Z)-N'-[(1Z,4Z)-4-ethyl-3-methylidenehexa-1,4-dienyl]pent-3-enimidamide |
|---|---|
| PubChem CID | 167106494 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | (Z)-N'-[(1Z,4Z)-4-ethyl-3-methylidenehexa-1,4-dienyl]pent-3-enimidamide |
| SMILES | C=C(/C=C\N=C(/N)C/C=C\C)/C(=C\C)CC |
| InChI | InChI=1S/C14H22N2/c1-5-8-9-14(15)16-11-10-12(4)13(6-2)7-3/h5-6,8,10-11H,4,7,9H2,1-3H3,(H2,15,16)/b8-5-,11-10-,13-6- |
| InChIKey | BQXNIXYLQJEBMA-XJIDXYGGSA-N |
| XLogP | 3.74 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|