About 7-ethylpteridin-2-amine
7-ethylpteridin-2-amine (PubChem CID 167106574) has the molecular formula C8H9N5
and a molecular weight of 175.19 g/mol. Its IUPAC name is 7-ethylpteridin-2-amine.
Molecular Properties
| Compound Name | 7-ethylpteridin-2-amine |
| PubChem CID | 167106574 |
| Molecular Formula | C8H9N5 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.09 |
| IUPAC Name | 7-ethylpteridin-2-amine |
| SMILES | CCc1cnc2cnc(N)nc2n1 |
| InChI | InChI=1S/C8H9N5/c1-2-5-3-10-6-4-11-8(9)13-7(6)12-5/h3-4H,2H2,1H3,(H2,9,11,12,13) |
| InChIKey | MKZGPULIXQFCEZ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-ethylpteridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethylpteridin-2-amine?
The IUPAC name of 7-ethylpteridin-2-amine (CID 167106574) is 7-ethylpteridin-2-amine.
What is the SMILES notation for 7-ethylpteridin-2-amine?
The canonical SMILES for 7-ethylpteridin-2-amine is CCc1cnc2cnc(N)nc2n1.
What is the InChIKey of 7-ethylpteridin-2-amine?
The InChIKey is MKZGPULIXQFCEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N5/c1-2-5-3-10-6-4-11-8(9)13-7(6)12-5/h3-4H,2H2,1H3,(H2,9,11,12,13).
What are the key properties of 7-ethylpteridin-2-amine?
7-ethylpteridin-2-amine has a molecular weight of 175.19 g/mol, XLogP of 0.56, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethylpteridin-2-amine is sourced from PubChem (CID 167106574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).