C18H37N — CID 167107327
4-(2,5-dimethylheptyl)-1-(2-methylpropyl)piperidine (PubChem CID 167107327) has the molecular formula C18H37N and a molecular weight of 267.50 g/mol. Its IUPAC name is 4-(2,5-dimethylheptyl)-1-(2-methylpropyl)piperidine.
| Compound Name | 4-(2,5-dimethylheptyl)-1-(2-methylpropyl)piperidine |
|---|---|
| PubChem CID | 167107327 |
| Molecular Formula | C18H37N |
| Molecular Weight | 267.50 g/mol |
| Exact Mass | 267.29 |
| IUPAC Name | 4-(2,5-dimethylheptyl)-1-(2-methylpropyl)piperidine |
| SMILES | CCC(C)CCC(C)CC1CCN(CC(C)C)CC1 |
| InChI | InChI=1S/C18H37N/c1-6-16(4)7-8-17(5)13-18-9-11-19(12-10-18)14-15(2)3/h15-18H,6-14H2,1-5H3 |
| InChIKey | XAKFPIKIFUZONG-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.50 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |