C17H23FN2O3 — CID 167107841
4-[[(3R,4S)-4-fluoro-1,4-dimethylpiperidin-3-yl]methyl-formylamino]-3-methylbenzoic acid (PubChem CID 167107841) has the molecular formula C17H23FN2O3 and a molecular weight of 322.38 g/mol. Its IUPAC name is 4-[[(3R,4S)-4-fluoro-1,4-dimethylpiperidin-3-yl]methyl-formylamino]-3-methylbenzoic acid.
| Compound Name | 4-[[(3R,4S)-4-fluoro-1,4-dimethylpiperidin-3-yl]methyl-formylamino]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 167107841 |
| Molecular Formula | C17H23FN2O3 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 4-[[(3R,4S)-4-fluoro-1,4-dimethylpiperidin-3-yl]methyl-formylamino]-3-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1N(C=O)C[C@H]1CN(C)CC[C@]1(C)F |
| InChI | InChI=1S/C17H23FN2O3/c1-12-8-13(16(22)23)4-5-15(12)20(11-21)10-14-9-19(3)7-6-17(14,2)18/h4-5,8,11,14H,6-7,9-10H2,1-3H3,(H,22,23)/t14-,17+/m1/s1 |
| InChIKey | FPBNYGUWOJNPLE-PBHICJAKSA-N |
| XLogP | 2.34 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|