About (Z)-N',2-dimethylidenehept-5-ene-1,7-diimine
(Z)-N',2-dimethylidenehept-5-ene-1,7-diimine (PubChem CID 167108316) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is (Z)-N',2-dimethylidenehept-5-ene-1,7-diimine.
Molecular Properties
| Compound Name | (Z)-N',2-dimethylidenehept-5-ene-1,7-diimine |
| PubChem CID | 167108316 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | (Z)-N',2-dimethylidenehept-5-ene-1,7-diimine |
| SMILES | [H]/N=C/C(=C)CC/C=C\CN=C |
| InChI | InChI=1S/C9H14N2/c1-9(8-10)6-4-3-5-7-11-2/h3,5,8,10H,1-2,4,6-7H2/b5-3-,10-8+ |
| InChIKey | VUHZAOYQAAVCFS-WEZLDLNLSA-N |
| XLogP | 2.23 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N',2-dimethylidenehept-5-ene-1,7-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N',2-dimethylidenehept-5-ene-1,7-diimine?
The IUPAC name of (Z)-N',2-dimethylidenehept-5-ene-1,7-diimine (CID 167108316) is (Z)-N',2-dimethylidenehept-5-ene-1,7-diimine.
What is the SMILES notation for (Z)-N',2-dimethylidenehept-5-ene-1,7-diimine?
The canonical SMILES for (Z)-N',2-dimethylidenehept-5-ene-1,7-diimine is [H]/N=C/C(=C)CC/C=C\CN=C.
What is the InChIKey of (Z)-N',2-dimethylidenehept-5-ene-1,7-diimine?
The InChIKey is VUHZAOYQAAVCFS-WEZLDLNLSA-N. The full InChI is InChI=1S/C9H14N2/c1-9(8-10)6-4-3-5-7-11-2/h3,5,8,10H,1-2,4,6-7H2/b5-3-,10-8+.
What are the key properties of (Z)-N',2-dimethylidenehept-5-ene-1,7-diimine?
(Z)-N',2-dimethylidenehept-5-ene-1,7-diimine has a molecular weight of 150.22 g/mol, XLogP of 2.23, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N',2-dimethylidenehept-5-ene-1,7-diimine is sourced from PubChem (CID 167108316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).