C33H36FN5O2S — CID 167108411
(4S)-6-[[2-(4-butan-2-ylphenyl)-1-oxo-3,3a,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-5-yl]methyl]-4-(3-fluoro-2-methylphenyl)-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carbaldehyde (PubChem CID 167108411) has the molecular formula C33H36FN5O2S and a molecular weight of 585.75 g/mol. Its IUPAC name is (4S)-6-[[2-(4-butan-2-ylphenyl)-1-oxo-3,3a,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-5-yl]methyl]-4-(3-fluoro-2-methylphenyl)-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carbaldehyde.
| Compound Name | (4S)-6-[[2-(4-butan-2-ylphenyl)-1-oxo-3,3a,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-5-yl]methyl]-4-(3-fluoro-2-methylphenyl)-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 167108411 |
| Molecular Formula | C33H36FN5O2S |
| Molecular Weight | 585.75 g/mol |
| Exact Mass | 585.26 |
| IUPAC Name | (4S)-6-[[2-(4-butan-2-ylphenyl)-1-oxo-3,3a,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-5-yl]methyl]-4-(3-fluoro-2-methylphenyl)-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carbaldehyde |
| SMILES | CCC(C)c1ccc(N2CC3CN(CC4=C(C=O)[C@H](c5cccc(F)c5C)N=C(c5nccs5)N4)CCC3C2=O)cc1 |
| InChI | InChI=1S/C33H36FN5O2S/c1-4-20(2)22-8-10-24(11-9-22)39-17-23-16-38(14-12-26(23)33(39)41)18-29-27(19-40)30(25-6-5-7-28(34)21(25)3)37-31(36-29)32-35-13-15-42-32/h5-11,13,15,19-20,23,26,30H,4,12,14,16-18H2,1-3H3,(H,36,37)/t20?,23?,26?,30-/m0/s1 |
| InChIKey | WTFCPEKMORFJNJ-VLKBKZOGSA-N |
| XLogP | 5.63 |
| TPSA | 77.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.75 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|