C21H22N2O2S — CID 167108954
4-[2-methyl-5-(4-phenyl-1H-pyrrol-3-yl)phenyl]sulfinylmorpholine (PubChem CID 167108954) has the molecular formula C21H22N2O2S and a molecular weight of 366.49 g/mol. Its IUPAC name is 4-[2-methyl-5-(4-phenyl-1H-pyrrol-3-yl)phenyl]sulfinylmorpholine.
| Compound Name | 4-[2-methyl-5-(4-phenyl-1H-pyrrol-3-yl)phenyl]sulfinylmorpholine |
|---|---|
| PubChem CID | 167108954 |
| Molecular Formula | C21H22N2O2S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 4-[2-methyl-5-(4-phenyl-1H-pyrrol-3-yl)phenyl]sulfinylmorpholine |
| SMILES | Cc1ccc(-c2c[nH]cc2-c2ccccc2)cc1S(=O)N1CCOCC1 |
| InChI | InChI=1S/C21H22N2O2S/c1-16-7-8-18(13-21(16)26(24)23-9-11-25-12-10-23)20-15-22-14-19(20)17-5-3-2-4-6-17/h2-8,13-15,22H,9-12H2,1H3 |
| InChIKey | DJCAEUKRTAYNNV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |