C21H25F3N4O — CID 167109293
3-(dimethylamino)-N-[4-[[2-(trifluoromethyl)-4-pyridinyl]amino]cyclohexyl]benzamide (PubChem CID 167109293) has the molecular formula C21H25F3N4O and a molecular weight of 406.45 g/mol. Its IUPAC name is 3-(dimethylamino)-N-[4-[[2-(trifluoromethyl)-4-pyridinyl]amino]cyclohexyl]benzamide.
| Compound Name | 3-(dimethylamino)-N-[4-[[2-(trifluoromethyl)-4-pyridinyl]amino]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 167109293 |
| Molecular Formula | C21H25F3N4O |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 3-(dimethylamino)-N-[4-[[2-(trifluoromethyl)-4-pyridinyl]amino]cyclohexyl]benzamide |
| SMILES | CN(C)c1cccc(C(=O)NC2CCC(Nc3ccnc(C(F)(F)F)c3)CC2)c1 |
| InChI | InChI=1S/C21H25F3N4O/c1-28(2)18-5-3-4-14(12-18)20(29)27-16-8-6-15(7-9-16)26-17-10-11-25-19(13-17)21(22,23)24/h3-5,10-13,15-16H,6-9H2,1-2H3,(H,25,26)(H,27,29) |
| InChIKey | HHPHWNXEHPRGAO-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |