C20H27NO2 — CID 167109489
5-butyl-2-[(1R,6R)-6-ethanimidoyl-3-methylcyclohex-2-en-1-yl]-3-methylcyclohexa-2,5-diene-1,4-dione (PubChem CID 167109489) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is 5-butyl-2-[(1R,6R)-6-ethanimidoyl-3-methylcyclohex-2-en-1-yl]-3-methylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 5-butyl-2-[(1R,6R)-6-ethanimidoyl-3-methylcyclohex-2-en-1-yl]-3-methylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 167109489 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 5-butyl-2-[(1R,6R)-6-ethanimidoyl-3-methylcyclohex-2-en-1-yl]-3-methylcyclohexa-2,5-diene-1,4-dione |
| SMILES | [H]/N=C(\C)[C@@H]1CCC(C)=C[C@H]1C1=C(C)C(=O)C(CCCC)=CC1=O |
| InChI | InChI=1S/C20H27NO2/c1-5-6-7-15-11-18(22)19(13(3)20(15)23)17-10-12(2)8-9-16(17)14(4)21/h10-11,16-17,21H,5-9H2,1-4H3/b21-14+/t16-,17+/m0/s1 |
| InChIKey | GYSZACFCRVBIRA-AMOAMQNHSA-N |
| XLogP | 4.58 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|