About 5-[5-chloro-4-(2-cyclopropylcyclopropyl)-1H-pyrrol-2-yl]-2,4-dimethoxypyrimidine
5-[5-chloro-4-(2-cyclopropylcyclopropyl)-1H-pyrrol-2-yl]-2,4-dimethoxypyrimidine (PubChem CID 167110248) has the molecular formula C16H18ClN3O2
and a molecular weight of 319.79 g/mol. Its IUPAC name is 5-[5-chloro-4-(2-cyclopropylcyclopropyl)-1H-pyrrol-2-yl]-2,4-dimethoxypyrimidine.
Molecular Properties
| Compound Name | 5-[5-chloro-4-(2-cyclopropylcyclopropyl)-1H-pyrrol-2-yl]-2,4-dimethoxypyrimidine |
| PubChem CID | 167110248 |
| Molecular Formula | C16H18ClN3O2 |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 5-[5-chloro-4-(2-cyclopropylcyclopropyl)-1H-pyrrol-2-yl]-2,4-dimethoxypyrimidine |
| SMILES | COc1ncc(-c2cc(C3CC3C3CC3)c(Cl)[nH]2)c(OC)n1 |
| InChI | InChI=1S/C16H18ClN3O2/c1-21-15-12(7-18-16(20-15)22-2)13-6-11(14(17)19-13)10-5-9(10)8-3-4-8/h6-10,19H,3-5H2,1-2H3 |
| InChIKey | NXYJISUIHAFSID-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[5-chloro-4-(2-cyclopropylcyclopropyl)-1H-pyrrol-2-yl]-2,4-dimethoxypyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-chloro-4-(2-cyclopropylcyclopropyl)-1H-pyrrol-2-yl]-2,4-dimethoxypyrimidine?
The IUPAC name of 5-[5-chloro-4-(2-cyclopropylcyclopropyl)-1H-pyrrol-2-yl]-2,4-dimethoxypyrimidine (CID 167110248) is 5-[5-chloro-4-(2-cyclopropylcyclopropyl)-1H-pyrrol-2-yl]-2,4-dimethoxypyrimidine.
What is the SMILES notation for 5-[5-chloro-4-(2-cyclopropylcyclopropyl)-1H-pyrrol-2-yl]-2,4-dimethoxypyrimidine?
The canonical SMILES for 5-[5-chloro-4-(2-cyclopropylcyclopropyl)-1H-pyrrol-2-yl]-2,4-dimethoxypyrimidine is COc1ncc(-c2cc(C3CC3C3CC3)c(Cl)[nH]2)c(OC)n1.
What is the InChIKey of 5-[5-chloro-4-(2-cyclopropylcyclopropyl)-1H-pyrrol-2-yl]-2,4-dimethoxypyrimidine?
The InChIKey is NXYJISUIHAFSID-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18ClN3O2/c1-21-15-12(7-18-16(20-15)22-2)13-6-11(14(17)19-13)10-5-9(10)8-3-4-8/h6-10,19H,3-5H2,1-2H3.
What are the key properties of 5-[5-chloro-4-(2-cyclopropylcyclopropyl)-1H-pyrrol-2-yl]-2,4-dimethoxypyrimidine?
5-[5-chloro-4-(2-cyclopropylcyclopropyl)-1H-pyrrol-2-yl]-2,4-dimethoxypyrimidine has a molecular weight of 319.79 g/mol, XLogP of 3.66, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-chloro-4-(2-cyclopropylcyclopropyl)-1H-pyrrol-2-yl]-2,4-dimethoxypyrimidine is sourced from PubChem (CID 167110248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).