C35H28F5O2Sb — CID 16711050
[tetrakis(4-methylphenyl)-λ5-stibanyl] 2,3,4,5,6-pentafluorobenzoate (PubChem CID 16711050) has the molecular formula C35H28F5O2Sb and a molecular weight of 697.36 g/mol. Its IUPAC name is [tetrakis(4-methylphenyl)-λ5-stibanyl] 2,3,4,5,6-pentafluorobenzoate.
| Compound Name | [tetrakis(4-methylphenyl)-λ5-stibanyl] 2,3,4,5,6-pentafluorobenzoate |
|---|---|
| PubChem CID | 16711050 |
| Molecular Formula | C35H28F5O2Sb |
| Molecular Weight | 697.36 g/mol |
| Exact Mass | 696.10 |
| IUPAC Name | [tetrakis(4-methylphenyl)-λ5-stibanyl] 2,3,4,5,6-pentafluorobenzoate |
| SMILES | Cc1ccc([Sb](OC(=O)c2c(F)c(F)c(F)c(F)c2F)(c2ccc(C)cc2)(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C7HF5O2.4C7H7.Sb/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10;4*1-7-5-3-2-4-6-7;/h(H,13,14);4*3-6H,1H3;/q;;;;;+1/p-1 |
| InChIKey | JOAMHFKFYRTABO-UHFFFAOYSA-M |
| XLogP | 6.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.36 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|