C23H26Cl2NO2P — CID 167111028
2-[2-[[3-[dichloro(diphenyl)-λ5-phosphanyl]phenyl]methoxy]ethoxy]ethanamine (PubChem CID 167111028) has the molecular formula C23H26Cl2NO2P and a molecular weight of 450.35 g/mol. Its IUPAC name is 2-[2-[[3-[dichloro(diphenyl)-λ5-phosphanyl]phenyl]methoxy]ethoxy]ethanamine.
| Compound Name | 2-[2-[[3-[dichloro(diphenyl)-λ5-phosphanyl]phenyl]methoxy]ethoxy]ethanamine |
|---|---|
| PubChem CID | 167111028 |
| Molecular Formula | C23H26Cl2NO2P |
| Molecular Weight | 450.35 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | 2-[2-[[3-[dichloro(diphenyl)-λ5-phosphanyl]phenyl]methoxy]ethoxy]ethanamine |
| SMILES | NCCOCCOCc1cccc(P(Cl)(Cl)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C23H26Cl2NO2P/c24-29(25,21-9-3-1-4-10-21,22-11-5-2-6-12-22)23-13-7-8-20(18-23)19-28-17-16-27-15-14-26/h1-13,18H,14-17,19,26H2 |
| InChIKey | SJURFKVEZAROIG-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.35 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|